Products 2229572-85-2
CAS 2229572-85-2 is the registry number for METHYL 4-(2-AMINO-1,1-DIFLUOROETHYL)BENZOATE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 4-(2-amino-1,1-difluoroethyl)benzoate (CAS 2229572-85-2) is a chemical compound with the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. IUPAC name: methyl 4-(2-amino-1,1-difluoroethyl)benzoate. InChIKey: ALAFWJLPHKIIHT-UHFFFAOYSA-N.
| Molecular formula | C10H11F2NO2 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | methyl 4-(2-amino-1,1-difluoroethyl)benzoate |
| InChIKey | ALAFWJLPHKIIHT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C(CN)(F)F |
Computed by PubChem (NCBI)