CAS 22364-35-8 is the registry number for Methyl 4-bromo-2-methyl-5-nitrobenzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Methyl 4-bromo-2-methyl-5-nitrobenzoate (CAS 22364-35-8) is a chemical compound with the molecular formula C9H8BrNO4 and a molecular weight of 274.07 g/mol. IUPAC name: methyl 4-bromo-2-methyl-5-nitrobenzoate. InChIKey: MHWVNOZRKHYKEL-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO4 |
|---|---|
| Molecular weight | 274.07 g/mol |
| IUPAC name | methyl 4-bromo-2-methyl-5-nitrobenzoate |
| InChIKey | MHWVNOZRKHYKEL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)OC)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)