CAS 22375-63-9 is the registry number for 3-Amino-4,7-dihydroxy-2H-chromen-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-amino-4,7-dihydroxycoumarin is a hydroxycoumarin that is 4,7-dihydroxycoumarin bearing an additional amino substituent at positions 3. It has a role as a metabolite. It is a conjugate acid of a 3-amino-4,7-dihydroxycoumarin(1-).
Source: ChEBI
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 3-amino-4,7-dihydroxychromen-2-one |
| InChIKey | QVNNPTBCHMRANE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)OC(=O)C(=C2O)N |
Computed by PubChem (NCBI)