Products 224054-19-7
CAS 224054-19-7 is the registry number for L-Ornithine-1,2-13C2 (hydrochloride). Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
(2S)-2,5-diamino(1,2-13C2)pentanoic acid;hydrochloride (CAS 224054-19-7) is a chemical compound with the molecular formula C5H13ClN2O2 and a molecular weight of 170.61 g/mol. IUPAC name: (2S)-2,5-diamino(1,2-13C2)pentanoic acid;hydrochloride. InChIKey: GGTYBZJRPHEQDG-GSAMYSAMSA-N.
| Molecular formula | C5H13ClN2O2 |
|---|---|
| Molecular weight | 170.61 g/mol |
| IUPAC name | (2S)-2,5-diamino(1,2-13C2)pentanoic acid;hydrochloride |
| InChIKey | GGTYBZJRPHEQDG-GSAMYSAMSA-N |
| SMILES | C(C[13C@@H]([13C](=O)O)N)CN.Cl |
Computed by PubChem (NCBI)