CAS 2483831-42-9 appears in our catalog under these names: L–Ornithine–d2 hydrochloride, L-Ornithine-d2 (hydrochloride), 99.94%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 1 mg, 25 mg, 5 mg, 50 mg, 10 mg, 100 mg.
(2S)-2,5-diamino-5,5-dideuteriopentanoic acid;hydrochloride (CAS 2483831-42-9) is a chemical compound with the molecular formula C5H13ClN2O2 and a molecular weight of 170.63 g/mol. IUPAC name: (2S)-2,5-diamino-5,5-dideuteriopentanoic acid;hydrochloride. InChIKey: GGTYBZJRPHEQDG-UWCRBIBNSA-N.
| Molecular formula | C5H13ClN2O2 |
|---|---|
| Molecular weight | 170.63 g/mol |
| IUPAC name | (2S)-2,5-diamino-5,5-dideuteriopentanoic acid;hydrochloride |
| InChIKey | GGTYBZJRPHEQDG-UWCRBIBNSA-N |
| SMILES | [2H]C([2H])(CC[C@@H](C(=O)O)N)N.Cl |
Computed by PubChem (NCBI)