Products 360565-59-9
CAS 360565-59-9 appears in our catalog under these names: L–Ornithine–15N2 hydrochloride, L-Ornithine-15N2 (hydrochloride), 98.90%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 5 mg, 10 mg, 1 mg.
(2S)-2,5-bis(15N)(azanyl)pentanoic acid;hydrochloride (CAS 360565-59-9) is a chemical compound with the molecular formula C5H13ClN2O2 and a molecular weight of 170.61 g/mol. IUPAC name: (2S)-2,5-bis(15N)(azanyl)pentanoic acid;hydrochloride. InChIKey: GGTYBZJRPHEQDG-HEDXIVCHSA-N.
| Molecular formula | C5H13ClN2O2 |
|---|---|
| Molecular weight | 170.61 g/mol |
| IUPAC name | (2S)-2,5-bis(15N)(azanyl)pentanoic acid;hydrochloride |
| InChIKey | GGTYBZJRPHEQDG-HEDXIVCHSA-N |
| SMILES | C(C[C@@H](C(=O)O)[15NH2])C[15NH2].Cl |
Computed by PubChem (NCBI)