Products 943962-21-8
CAS 943962-21-8 is the registry number for L-Ornithine-1,2,3,4,5-13C5 (hydrochloride), 99.5%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 10 mg, 25 mg, 5 mg, 1 mg.
(2S)-2,5-diamino(1,2,3,4,5-13C5)pentanoic acid;hydrochloride (CAS 943962-21-8) is a chemical compound with the molecular formula C5H13ClN2O2 and a molecular weight of 173.58 g/mol. IUPAC name: (2S)-2,5-diamino(1,2,3,4,5-13C5)pentanoic acid;hydrochloride. InChIKey: GGTYBZJRPHEQDG-AOVYFNJDSA-N.
| Molecular formula | C5H13ClN2O2 |
|---|---|
| Molecular weight | 173.58 g/mol |
| IUPAC name | (2S)-2,5-diamino(1,2,3,4,5-13C5)pentanoic acid;hydrochloride |
| InChIKey | GGTYBZJRPHEQDG-AOVYFNJDSA-N |
| SMILES | [13CH2]([13CH2][13C@@H]([13C](=O)O)N)[13CH2]N.Cl |
Computed by PubChem (NCBI)