Products 2241140-78-1
CAS 2241140-78-1 is the registry number for 3,7-Diazatricyclo(3.3.3.0,1,5)undecane-2,4-dione hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3,7-diazatricyclo[3.3.3.01,5]undecane-2,4-dione;hydrochloride (CAS 2241140-78-1) is a chemical compound with the molecular formula C9H13ClN2O2 and a molecular weight of 216.66 g/mol. IUPAC name: 3,7-diazatricyclo[3.3.3.01,5]undecane-2,4-dione;hydrochloride. InChIKey: BZXRUAXDAHQECZ-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 3,7-diazatricyclo[3.3.3.01,5]undecane-2,4-dione;hydrochloride |
| InChIKey | BZXRUAXDAHQECZ-UHFFFAOYSA-N |
| SMILES | C1CC23CNCC2(C1)C(=O)NC3=O.Cl |
Computed by PubChem (NCBI)