CAS 2243810-16-2 appears in our catalog under these names: 4-Hydroxy-1-methyl-7-phenoxyquinolin-2(1H)-one 98%, 4-Hydroxy-1-methyl-7-phenoxyquinolin-2(1H)-one, 98%. Offered by: Ambeed, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg.
4-hydroxy-1-methyl-7-phenoxyquinolin-2-one (CAS 2243810-16-2) is a chemical compound with the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. IUPAC name: 4-hydroxy-1-methyl-7-phenoxyquinolin-2-one. InChIKey: YSAGREGBQPWKNX-UHFFFAOYSA-N.
| Molecular formula | C16H13NO3 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | 4-hydroxy-1-methyl-7-phenoxyquinolin-2-one |
| InChIKey | YSAGREGBQPWKNX-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)OC3=CC=CC=C3)C(=CC1=O)O |
Computed by PubChem (NCBI)