CAS 2246719-66-2 appears in our catalog under these names: 6,8-Dichloro-2,7-naphthyridin-3-amine, 97%, 6,8-Dichloro-2,7-naphthyridin-3-amine 95%, 6,8-dichloro-2,7-naphthyridin-3-amine, 97%, 97%, 6,8-DICHLORO-2,7-NAPHTHYRIDIN-3-AMINE, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 50mg, 250mg, 100mg, 500mg, 1g, 5g.
6,8-dichloro-2,7-naphthyridin-3-amine (CAS 2246719-66-2) is a chemical compound with the molecular formula C8H5Cl2N3 and a molecular weight of 214.05 g/mol. IUPAC name: 6,8-dichloro-2,7-naphthyridin-3-amine. InChIKey: JMGZEPPXYZVFOK-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3 |
|---|---|
| Molecular weight | 214.05 g/mol |
| IUPAC name | 6,8-dichloro-2,7-naphthyridin-3-amine |
| InChIKey | JMGZEPPXYZVFOK-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(N=C(C2=CN=C1N)Cl)Cl |
Computed by PubChem (NCBI)