Products 2247102-42-5
CAS 2247102-42-5 is the registry number for 3a-Methyl-1,1-dioxo-hexahydro-1λ6-pyrrolo(1,2-b)(1,2)thiazole-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3a-methyl-1,1-dioxo-3,4,5,6-tetrahydro-2H-pyrrolo[1,2-b][1,2]thiazole-2-carboxylic acid (CAS 2247102-42-5) is a chemical compound with the molecular formula C8H13NO4S and a molecular weight of 219.26 g/mol. IUPAC name: 3a-methyl-1,1-dioxo-3,4,5,6-tetrahydro-2H-pyrrolo[1,2-b][1,2]thiazole-2-carboxylic acid. InChIKey: ILHLKYQHASWNBN-UHFFFAOYSA-N.
| Molecular formula | C8H13NO4S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | 3a-methyl-1,1-dioxo-3,4,5,6-tetrahydro-2H-pyrrolo[1,2-b][1,2]thiazole-2-carboxylic acid |
| InChIKey | ILHLKYQHASWNBN-UHFFFAOYSA-N |
| SMILES | CC12CCCN1S(=O)(=O)C(C2)C(=O)O |
Computed by PubChem (NCBI)