Products 2248272-02-6
CAS 2248272-02-6 is the registry number for 4-(Difluoromethyl)-2-(trifluoromethyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 5g.
4-(difluoromethyl)-2-(trifluoromethyl)benzoic acid (CAS 2248272-02-6) is a chemical compound with the molecular formula C9H5F5O2 and a molecular weight of 240.13 g/mol. IUPAC name: 4-(difluoromethyl)-2-(trifluoromethyl)benzoic acid. InChIKey: IVFITDGLWGKMKC-UHFFFAOYSA-N.
| Molecular formula | C9H5F5O2 |
|---|---|
| Molecular weight | 240.13 g/mol |
| IUPAC name | 4-(difluoromethyl)-2-(trifluoromethyl)benzoic acid |
| InChIKey | IVFITDGLWGKMKC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)F)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)