Products 2248290-21-1
CAS 2248290-21-1 appears in our catalog under these names: 3-(Difluoromethyl)-5-(trifluoromethyl)benzoic acid, 95%, 95%, 3-(Difluoromethyl)-5-(trifluoromethyl)benzoic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g.
3-(difluoromethyl)-5-(trifluoromethyl)benzoic acid (CAS 2248290-21-1) is a chemical compound with the molecular formula C9H5F5O2 and a molecular weight of 240.13 g/mol. IUPAC name: 3-(difluoromethyl)-5-(trifluoromethyl)benzoic acid. InChIKey: VTAKRCVGSOFIOY-UHFFFAOYSA-N.
| Molecular formula | C9H5F5O2 |
|---|---|
| Molecular weight | 240.13 g/mol |
| IUPAC name | 3-(difluoromethyl)-5-(trifluoromethyl)benzoic acid |
| InChIKey | VTAKRCVGSOFIOY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)C(F)(F)F)C(F)F |
Computed by PubChem (NCBI)