Products 2248351-76-8
CAS 2248351-76-8 is the registry number for 3-(3,4-Difluorophenyl)-2-methylpyrrolidine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(3,4-difluorophenyl)-2-methylpyrrolidine;hydrochloride (CAS 2248351-76-8) is a chemical compound with the molecular formula C11H14ClF2N and a molecular weight of 233.68 g/mol. IUPAC name: 3-(3,4-difluorophenyl)-2-methylpyrrolidine;hydrochloride. InChIKey: LKOHZUMEDQTYHF-UHFFFAOYSA-N.
| Molecular formula | C11H14ClF2N |
|---|---|
| Molecular weight | 233.68 g/mol |
| IUPAC name | 3-(3,4-difluorophenyl)-2-methylpyrrolidine;hydrochloride |
| InChIKey | LKOHZUMEDQTYHF-UHFFFAOYSA-N |
| SMILES | CC1C(CCN1)C2=CC(=C(C=C2)F)F.Cl |
Computed by PubChem (NCBI)