CAS 22509-74-6 appears in our catalog under these names: N-Carbethoxyphthalimide, N–Ethoxycarbonylphthalimide, ECPT, N-Ethoxycarbonylphthalimide [for Peptide Synthesis], >98.0%(N), N-Carbethoxyphthalimide, 99+%. Offered by: TRC, GLPBio, Iris Biotech, TCI, Thermo Scientific (Acros). Available pack sizes: 10g, 1g, 5g, 100g, 500g, 25g, 50g, 250g.
Ethyl 1,3-dioxoisoindole-2-carboxylate (CAS 22509-74-6) is a chemical compound with the molecular formula C11H9NO4 and a molecular weight of 219.19 g/mol. IUPAC name: ethyl 1,3-dioxoisoindole-2-carboxylate. InChIKey: VRHAQNTWKSVEEC-UHFFFAOYSA-N.
| Molecular formula | C11H9NO4 |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | ethyl 1,3-dioxoisoindole-2-carboxylate |
| InChIKey | VRHAQNTWKSVEEC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)