CAS 2253619-94-0 is the registry number for (1R)-2-Phenyl-1-(1H-1,2,4-triazol-3-yl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1R)-2-phenyl-1-(1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride (CAS 2253619-94-0) is a chemical compound with the molecular formula C10H13ClN4 and a molecular weight of 224.69 g/mol. IUPAC name: (1R)-2-phenyl-1-(1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride. InChIKey: RYBQQQJRNPHXIL-SBSPUUFOSA-N.
| Molecular formula | C10H13ClN4 |
|---|---|
| Molecular weight | 224.69 g/mol |
| IUPAC name | (1R)-2-phenyl-1-(1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride |
| InChIKey | RYBQQQJRNPHXIL-SBSPUUFOSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](C2=NC=NN2)N.Cl |
Computed by PubChem (NCBI)