Products 2260629-83-0
CAS 2260629-83-0 is the registry number for GW-117. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[2-[6-chloro-7-(trideuteriomethoxy)naphthalen-1-yl]ethyl]acetamide (CAS 2260629-83-0) is a chemical compound with the molecular formula C15H16ClNO2 and a molecular weight of 280.76 g/mol. IUPAC name: N-[2-[6-chloro-7-(trideuteriomethoxy)naphthalen-1-yl]ethyl]acetamide. InChIKey: KNYFIWBFKFDCTJ-BMSJAHLVSA-N.
| Molecular formula | C15H16ClNO2 |
|---|---|
| Molecular weight | 280.76 g/mol |
| IUPAC name | N-[2-[6-chloro-7-(trideuteriomethoxy)naphthalen-1-yl]ethyl]acetamide |
| InChIKey | KNYFIWBFKFDCTJ-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C2C=CC=C(C2=C1)CCNC(=O)C)Cl |
Computed by PubChem (NCBI)