CAS 22608-87-3 appears in our catalog under these names: 2-Amino-4,5-dimethoxybenzaldehyde, 97%, 97%, 2-Amino-4,5-dimethoxybenzaldehyde, 97%, 2-Amino-4,5-dimethoxybenzaldehyde, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-amino-4,5-dimethoxybenzaldehyde (CAS 22608-87-3) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 2-amino-4,5-dimethoxybenzaldehyde. InChIKey: FLTCPRADVSSLDM-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 2-amino-4,5-dimethoxybenzaldehyde |
| InChIKey | FLTCPRADVSSLDM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C=O)N)OC |
Computed by PubChem (NCBI)