Products 2265903-35-1
CAS 2265903-35-1 is the registry number for 3-Ethenyl-N,N-dimethyl-4-(1-methylethoxy)benzenesulfonamide, 97%. Offered by: Chemat. Available pack sizes: 100mg.
3-ethenyl-N,N-dimethyl-4-propan-2-yloxybenzenesulfonamide (CAS 2265903-35-1) is a chemical compound with the molecular formula C13H19NO3S and a molecular weight of 269.36 g/mol. IUPAC name: 3-ethenyl-N,N-dimethyl-4-propan-2-yloxybenzenesulfonamide. InChIKey: SPFTXTGMFMWRFM-UHFFFAOYSA-N.
| Molecular formula | C13H19NO3S |
|---|---|
| Molecular weight | 269.36 g/mol |
| IUPAC name | 3-ethenyl-N,N-dimethyl-4-propan-2-yloxybenzenesulfonamide |
| InChIKey | SPFTXTGMFMWRFM-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1)S(=O)(=O)N(C)C)C=C |
Computed by PubChem (NCBI)