Products 2266586-31-4
CAS 2266586-31-4 is the registry number for 2-Methoxy-1,6-dimethyl-5-vinyl-9,10-dihydrophenanthren-7-ol. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-ethenyl-7-methoxy-3,8-dimethyl-9,10-dihydrophenanthren-2-ol (CAS 2266586-31-4) is a chemical compound with the molecular formula C19H20O2 and a molecular weight of 280.4 g/mol. IUPAC name: 4-ethenyl-7-methoxy-3,8-dimethyl-9,10-dihydrophenanthren-2-ol. InChIKey: KGLVYONNJLOYTL-UHFFFAOYSA-N.
| Molecular formula | C19H20O2 |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | 4-ethenyl-7-methoxy-3,8-dimethyl-9,10-dihydrophenanthren-2-ol |
| InChIKey | KGLVYONNJLOYTL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1CCC3=CC(=C(C(=C32)C=C)C)O)OC |
Computed by PubChem (NCBI)