Products 2268817-78-1
CAS 2268817-78-1 is the registry number for 6-Nitro-1-(trifluoromethyl)-1-indanol, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
6-nitro-1-(trifluoromethyl)-2,3-dihydroinden-1-ol (CAS 2268817-78-1) is a chemical compound with the molecular formula C10H8F3NO3 and a molecular weight of 247.17 g/mol. IUPAC name: 6-nitro-1-(trifluoromethyl)-2,3-dihydroinden-1-ol. InChIKey: PBCMSSUIKXUHHC-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO3 |
|---|---|
| Molecular weight | 247.17 g/mol |
| IUPAC name | 6-nitro-1-(trifluoromethyl)-2,3-dihydroinden-1-ol |
| InChIKey | PBCMSSUIKXUHHC-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C1C=CC(=C2)[N+](=O)[O-])(C(F)(F)F)O |
Computed by PubChem (NCBI)