CAS 226901-49-1 appears in our catalog under these names: 5-Nitro-1-indoleacetic acid ethyl ester, 95%, Ethyl 5-nitro-1H-indole-1-acetate, 95%+, 95%+, (5-NITRO-1H-INDOL-1-YL)-ACETIC ACID ETHYL ESTER, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
Ethyl 2-(5-nitroindol-1-yl)acetate (CAS 226901-49-1) is a chemical compound with the molecular formula C12H12N2O4 and a molecular weight of 248.23 g/mol. IUPAC name: ethyl 2-(5-nitroindol-1-yl)acetate. InChIKey: WZZYPIGFBQMUAT-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O4 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | ethyl 2-(5-nitroindol-1-yl)acetate |
| InChIKey | WZZYPIGFBQMUAT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1C=CC2=C1C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)