CAS 227783-03-1 is the registry number for (1R,3S)-3-(Ethoxycarbonyl)cyclohexane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Cis-(1R,3S)-3-ethoxycarbonylcyclohexane-1-carboxylic acid (CAS 227783-03-1) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: cis-(1R,3S)-3-ethoxycarbonylcyclohexane-1-carboxylic acid. InChIKey: WFXPHQCHMAPWEB-SFYZADRCSA-N.
| Molecular formula | C10H16O4 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | cis-(1R,3S)-3-ethoxycarbonylcyclohexane-1-carboxylic acid |
| InChIKey | WFXPHQCHMAPWEB-SFYZADRCSA-N |
| SMILES | CCOC(=O)[C@H]1CCC[C@H](C1)C(=O)O |
Computed by PubChem (NCBI)