CAS 2287271-02-5 appears in our catalog under these names: 4'H,6'H-Spiro(cyclopropane-1,5'-pyrrolo(1,2-b)pyrazole)-2'-carboxylic acid, 98%, 4',6'-Dihydrospiro(cyclopropane-1,5'-pyrrolo(1,2-b)pyrazole)-2'-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 25mg, 100mg, 500mg, 250mg.
Spiro[4,6-dihydropyrrolo[2,1-e]pyrazole-5,1'-cyclopropane]-2-carboxylic acid (CAS 2287271-02-5) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: spiro[4,6-dihydropyrrolo[2,1-e]pyrazole-5,1'-cyclopropane]-2-carboxylic acid. InChIKey: LKEOFDAOEVNGFL-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | spiro[4,6-dihydropyrrolo[2,1-e]pyrazole-5,1'-cyclopropane]-2-carboxylic acid |
| InChIKey | LKEOFDAOEVNGFL-UHFFFAOYSA-N |
| SMILES | C1CC12CC3=CC(=NN3C2)C(=O)O |
Computed by PubChem (NCBI)