Products 2287323-23-1
CAS 2287323-23-1 is the registry number for 6-Chloroquinoline-7-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-chloroquinoline-7-carboxylic acid;hydrochloride (CAS 2287323-23-1) is a chemical compound with the molecular formula C10H7Cl2NO2 and a molecular weight of 244.07 g/mol. IUPAC name: 6-chloroquinoline-7-carboxylic acid;hydrochloride. InChIKey: YOMJNTYNWZWMFG-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO2 |
|---|---|
| Molecular weight | 244.07 g/mol |
| IUPAC name | 6-chloroquinoline-7-carboxylic acid;hydrochloride |
| InChIKey | YOMJNTYNWZWMFG-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C(C=C2N=C1)C(=O)O)Cl.Cl |
Computed by PubChem (NCBI)