Products 2287334-49-8
CAS 2287334-49-8 is the registry number for Methyl 4-(furan-2-carbonyl)-1H-pyrrole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
Methyl 4-(furan-2-carbonyl)-1H-pyrrole-2-carboxylate (CAS 2287334-49-8) is a chemical compound with the molecular formula C11H9NO4 and a molecular weight of 219.19 g/mol. IUPAC name: methyl 4-(furan-2-carbonyl)-1H-pyrrole-2-carboxylate. InChIKey: KIWHIZKQEUXJGR-UHFFFAOYSA-N.
| Molecular formula | C11H9NO4 |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | methyl 4-(furan-2-carbonyl)-1H-pyrrole-2-carboxylate |
| InChIKey | KIWHIZKQEUXJGR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CN1)C(=O)C2=CC=CO2 |
Computed by PubChem (NCBI)