Products 2287344-01-6

CAS 2287344-01-6 is the registry number for Propyl 2-methylbenzene-1-sulfonate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Propyl 2-methylbenzenesulfonate (CAS 2287344-01-6) is a chemical compound with the molecular formula C10H14O3S and a molecular weight of 214.28 g/mol. IUPAC name: propyl 2-methylbenzenesulfonate. InChIKey: KLWJIJJDQKQAFS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14O3S
Molecular weight214.28 g/mol
IUPAC namepropyl 2-methylbenzenesulfonate
InChIKeyKLWJIJJDQKQAFS-UHFFFAOYSA-N
SMILESCCCOS(=O)(=O)C1=CC=CC=C1C

Computed by PubChem (NCBI)