CAS 2292095-12-4 is the registry number for (4R)-1,2,3,4-Tetrahydro-2-methyl-4,6-isoquinolinediol Hydrochloride. Offered by: TRC. Available pack sizes: 10mg.
(4R)-2-methyl-3,4-dihydro-1H-isoquinoline-4,6-diol;hydrochloride (CAS 2292095-12-4) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: (4R)-2-methyl-3,4-dihydro-1H-isoquinoline-4,6-diol;hydrochloride. InChIKey: NQWCCJZOYHZSNW-PPHPATTJSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | (4R)-2-methyl-3,4-dihydro-1H-isoquinoline-4,6-diol;hydrochloride |
| InChIKey | NQWCCJZOYHZSNW-PPHPATTJSA-N |
| SMILES | CN1C[C@@H](C2=C(C1)C=CC(=C2)O)O.Cl |
Computed by PubChem (NCBI)