Products 57196-61-9
CAS 57196-61-9 appears in our catalog under these names: 1,2,3,4-Tetrahydro-4,6-dihydroxy-2-methylisoquinoline HCl, 2-Methyl-1,2,3,4-tetrahydroisoquinoline-4,6-diol hydrochloride, 95+%, 1,2,3,4-Tetrahydro-4,6-dihydroxy-2-methyl-isoquinoline Hydrochloride. Offered by: Chemat Brand, Mikromol. Available pack sizes: on request, 25mg, 100mg.
2-methyl-3,4-dihydro-1H-isoquinoline-4,6-diol;hydrochloride (CAS 57196-61-9) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: 2-methyl-3,4-dihydro-1H-isoquinoline-4,6-diol;hydrochloride. InChIKey: NQWCCJZOYHZSNW-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | 2-methyl-3,4-dihydro-1H-isoquinoline-4,6-diol;hydrochloride |
| InChIKey | NQWCCJZOYHZSNW-UHFFFAOYSA-N |
| SMILES | CN1CC(C2=C(C1)C=CC(=C2)O)O.Cl |
Computed by PubChem (NCBI)