Products 22979-35-7
CAS 22979-35-7 is the registry number for A-DIAZO-BENZENEACETIC ACID METHYL ESTER, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
Methyl 2-diazo-2-phenylacetate (CAS 22979-35-7) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: methyl 2-diazo-2-phenylacetate. InChIKey: HYAAEBUKCXOFDT-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | methyl 2-diazo-2-phenylacetate |
| InChIKey | HYAAEBUKCXOFDT-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=[N+]=[N-])C1=CC=CC=C1 |
Computed by PubChem (NCBI)
Synonyms:
METHYL PHENYLDIAZOACETATE, Benzeneacetic acid, alpha-diazo-, methyl ester, Methyl 2-diazo-2-phenylacetate, a-Diazo-benzeneacetic acid methyl ester, Benzeneacetic acid, a-diazo-, methyl ester, Methyl diazophenylacetate, Carbomethoxyphenyldiazomethane, methyl 2-diazo-2-phenyl-acetate, HYAAEBUKCXOFDT-UHFFFAOYSA-N, alpha-DiaZobenZeneacetic acid methyl ester