Products 2301856-77-7
CAS 2301856-77-7 is the registry number for 3-Methyl-1-pyridin-2-yl-1h-pyrazol-5-ol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
5-methyl-2-pyridin-2-yl-1H-pyrazol-3-one;hydrochloride (CAS 2301856-77-7) is a chemical compound with the molecular formula C9H10ClN3O and a molecular weight of 211.65 g/mol. IUPAC name: 5-methyl-2-pyridin-2-yl-1H-pyrazol-3-one;hydrochloride. InChIKey: QHBGYJZDMXGELT-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3O |
|---|---|
| Molecular weight | 211.65 g/mol |
| IUPAC name | 5-methyl-2-pyridin-2-yl-1H-pyrazol-3-one;hydrochloride |
| InChIKey | QHBGYJZDMXGELT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N(N1)C2=CC=CC=N2.Cl |
Computed by PubChem (NCBI)