Products 303149-95-3
CAS 303149-95-3 is the registry number for 1-(6-Chloropyridazin-3-yl)piperidin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
1-(6-chloropyridazin-3-yl)piperidin-4-one (CAS 303149-95-3) is a chemical compound with the molecular formula C9H10ClN3O and a molecular weight of 211.65 g/mol. IUPAC name: 1-(6-chloropyridazin-3-yl)piperidin-4-one. InChIKey: ZKVKANRUWLPPNA-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3O |
|---|---|
| Molecular weight | 211.65 g/mol |
| IUPAC name | 1-(6-chloropyridazin-3-yl)piperidin-4-one |
| InChIKey | ZKVKANRUWLPPNA-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1=O)C2=NN=C(C=C2)Cl |
Computed by PubChem (NCBI)