Products 14760-30-6
CAS 14760-30-6 appears in our catalog under these names: 3'-Chloroacetophenone semicarbazone, 98%, 3'-Chloroacetophenone semicarbazone. Offered by: Combi-blocks, Chemat. Available pack sizes: 25g, 5g, 1g, 50mg, 250mg.
[(E)-1-(3-chlorophenyl)ethylideneamino]urea (CAS 14760-30-6) is a chemical compound with the molecular formula C9H10ClN3O and a molecular weight of 211.65 g/mol. IUPAC name: [(E)-1-(3-chlorophenyl)ethylideneamino]urea. InChIKey: FMBJODQYWAEYGJ-WUXMJOGZSA-N.
| Molecular formula | C9H10ClN3O |
|---|---|
| Molecular weight | 211.65 g/mol |
| IUPAC name | [(E)-1-(3-chlorophenyl)ethylideneamino]urea |
| InChIKey | FMBJODQYWAEYGJ-WUXMJOGZSA-N |
| SMILES | C/C(=N\NC(=O)N)/C1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)