CAS 1187931-09-4 appears in our catalog under these names: (5-Phenyl-1,3,4-oxadiazol-2-yl)methanamine hydrochloride, 95%, (5-Phenyl-1,3,4-oxadiazol-2-yl)methanamine hydrochloride, 96%, (5-Phenyl-1,3,4-oxadiazol-2-yl)methanamine hydrochloride, [(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]amine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
(5-phenyl-1,3,4-oxadiazol-2-yl)methanamine;hydrochloride (CAS 1187931-09-4) is a chemical compound with the molecular formula C9H10ClN3O and a molecular weight of 211.65 g/mol. IUPAC name: (5-phenyl-1,3,4-oxadiazol-2-yl)methanamine;hydrochloride. InChIKey: MFFARWJMWVFLIW-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3O |
|---|---|
| Molecular weight | 211.65 g/mol |
| IUPAC name | (5-phenyl-1,3,4-oxadiazol-2-yl)methanamine;hydrochloride |
| InChIKey | MFFARWJMWVFLIW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(O2)CN.Cl |
Computed by PubChem (NCBI)