CAS 120445-83-2 is the registry number for 2'-Chloroacetophenone semicarbazone, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
[(E)-1-(2-chlorophenyl)ethylideneamino]urea (CAS 120445-83-2) is a chemical compound with the molecular formula C9H10ClN3O and a molecular weight of 211.65 g/mol. IUPAC name: [(E)-1-(2-chlorophenyl)ethylideneamino]urea. InChIKey: QRYYNWCEQGXCED-WUXMJOGZSA-N.
| Molecular formula | C9H10ClN3O |
|---|---|
| Molecular weight | 211.65 g/mol |
| IUPAC name | [(E)-1-(2-chlorophenyl)ethylideneamino]urea |
| InChIKey | QRYYNWCEQGXCED-WUXMJOGZSA-N |
| SMILES | C/C(=N\NC(=O)N)/C1=CC=CC=C1Cl |
Computed by PubChem (NCBI)