CAS 2007917-52-2 appears in our catalog under these names: 4-Chloro-5,5,7-trimethyl-5h,6h,7h-pyrrolo[2,3-d]pyrimidin-6-one, 95%, 4-Chloro-5,5,7-trimethyl-5H-pyrrolo(2,3-d)pyrimidin-6(7H)-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
4-chloro-5,5,7-trimethylpyrrolo[2,3-d]pyrimidin-6-one (CAS 2007917-52-2) is a chemical compound with the molecular formula C9H10ClN3O and a molecular weight of 211.65 g/mol. IUPAC name: 4-chloro-5,5,7-trimethylpyrrolo[2,3-d]pyrimidin-6-one. InChIKey: SXKGAYOVBAXDAR-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3O |
|---|---|
| Molecular weight | 211.65 g/mol |
| IUPAC name | 4-chloro-5,5,7-trimethylpyrrolo[2,3-d]pyrimidin-6-one |
| InChIKey | SXKGAYOVBAXDAR-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(N=CN=C2Cl)N(C1=O)C)C |
Computed by PubChem (NCBI)