CAS 7575-74-8 is the registry number for 4'-Chloroacetophenone semicarbazone, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 25g.
[(E)-1-(4-chlorophenyl)ethylideneamino]urea (CAS 7575-74-8) is a chemical compound with the molecular formula C9H10ClN3O and a molecular weight of 211.65 g/mol. IUPAC name: [(E)-1-(4-chlorophenyl)ethylideneamino]urea. InChIKey: NRVQPAZCFBJKNE-WUXMJOGZSA-N.
| Molecular formula | C9H10ClN3O |
|---|---|
| Molecular weight | 211.65 g/mol |
| IUPAC name | [(E)-1-(4-chlorophenyl)ethylideneamino]urea |
| InChIKey | NRVQPAZCFBJKNE-WUXMJOGZSA-N |
| SMILES | C/C(=N\NC(=O)N)/C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)