Products 2306252-85-5

CAS 2306252-85-5 is the registry number for Methyl (3S,4S)-4-cyclopropylpyrrolidine-3-carboxylate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 4-cyclopropylpyrrolidine-3-carboxylate;hydrochloride (CAS 2306252-85-5) is a chemical compound with the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. IUPAC name: methyl 4-cyclopropylpyrrolidine-3-carboxylate;hydrochloride. InChIKey: SQZFGRAFYOLNEG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16ClNO2
Molecular weight205.68 g/mol
IUPAC namemethyl 4-cyclopropylpyrrolidine-3-carboxylate;hydrochloride
InChIKeySQZFGRAFYOLNEG-UHFFFAOYSA-N
SMILESCOC(=O)C1CNCC1C2CC2.Cl

Computed by PubChem (NCBI)