CAS 23077-42-1 appears in our catalog under these names: 4-fluoro-1H-indole-3-carboxylic acid, 96%, 96%, 4-Fluoro-1H-indole-3-carboxylic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
4-fluoro-1H-indole-3-carboxylic acid (CAS 23077-42-1) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 4-fluoro-1H-indole-3-carboxylic acid. InChIKey: RDCCTSJRSSJAFO-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 4-fluoro-1H-indole-3-carboxylic acid |
| InChIKey | RDCCTSJRSSJAFO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)C(=CN2)C(=O)O |
Computed by PubChem (NCBI)