Products 2309172-24-3
CAS 2309172-24-3 appears in our catalog under these names: ABO (hydrochloride), ABO (hydrochloride), 98.7%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 5 mg, 1 mg.
(6-amino-3,4-dihydro-2H-1,4-benzoxazin-3-yl)methanol;dihydrochloride (CAS 2309172-24-3) is a chemical compound with the molecular formula C9H14Cl2N2O2 and a molecular weight of 253.12 g/mol. IUPAC name: (6-amino-3,4-dihydro-2H-1,4-benzoxazin-3-yl)methanol;dihydrochloride. InChIKey: WQHCJHKXKVXAEW-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2O2 |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | (6-amino-3,4-dihydro-2H-1,4-benzoxazin-3-yl)methanol;dihydrochloride |
| InChIKey | WQHCJHKXKVXAEW-UHFFFAOYSA-N |
| SMILES | C1C(NC2=C(O1)C=CC(=C2)N)CO.Cl.Cl |
Computed by PubChem (NCBI)