Products 23094-61-3

CAS 23094-61-3 is the registry number for Ribavirin Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[(2R,3S,4R,5S)-3,4,5-triacetyloxyoxolan-2-yl]methyl acetate (CAS 23094-61-3) is a chemical compound with the molecular formula C13H18O9 and a molecular weight of 318.28 g/mol. IUPAC name: [(2R,3S,4R,5S)-3,4,5-triacetyloxyoxolan-2-yl]methyl acetate. InChIKey: IHNHAHWGVLXCCI-YVECIDJPSA-N.

Identity
Molecular formulaC13H18O9
Molecular weight318.28 g/mol
IUPAC name[(2R,3S,4R,5S)-3,4,5-triacetyloxyoxolan-2-yl]methyl acetate
InChIKeyIHNHAHWGVLXCCI-YVECIDJPSA-N
SMILESCC(=O)OC[C@@H]1[C@@H]([C@H]([C@@H](O1)OC(=O)C)OC(=O)C)OC(=O)C

Computed by PubChem (NCBI)