CAS 28708-32-9 appears in our catalog under these names: (3R,4R,5R)-5-(Acetoxymethyl)tetrahydrofuran-2,3,4-triyl triacetate, 95%, Ribavirin Impurity 19 (Mixture of alpha- and beta- Isomers), (3R,4R,5R)-5-(Acetoxymethyl)tetrahydrofuran-2,3,4-triyl triacetate, 98%, (3R,4R,5R)–5–(Acetoxymethyl)tetrahydrofuran–2,3,4–triyl triacetate, 1,2,3,5-Tetra-O-acetyl-D-ribofuranose. Offered by: Combi-blocks, Chemat Brand, AmBeed, GLPBio, Biosynth. Available pack sizes: 25g, 1kg, 500g, 100g, 5g, on request, 1g, 2.5kg.
[(2R,3R,4R)-3,4,5-triacetyloxyoxolan-2-yl]methyl acetate (CAS 28708-32-9) is a chemical compound with the molecular formula C13H18O9 and a molecular weight of 318.28 g/mol. IUPAC name: [(2R,3R,4R)-3,4,5-triacetyloxyoxolan-2-yl]methyl acetate. InChIKey: IHNHAHWGVLXCCI-PFGBXZAXSA-N.
| Molecular formula | C13H18O9 |
|---|---|
| Molecular weight | 318.28 g/mol |
| IUPAC name | [(2R,3R,4R)-3,4,5-triacetyloxyoxolan-2-yl]methyl acetate |
| InChIKey | IHNHAHWGVLXCCI-PFGBXZAXSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@H](C(O1)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)