CAS 50730-26-2 appears in our catalog under these names: Ribavirin Impurity 17 (alpha-Ribofuranose tetraacetate), Ribavirin Impurity M, Ribavirin Impurity 9. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(2R,3R,4R,5R)-3,4,5-triacetyloxyoxolan-2-yl]methyl acetate (CAS 50730-26-2) is a chemical compound with the molecular formula C13H18O9 and a molecular weight of 318.28 g/mol. IUPAC name: [(2R,3R,4R,5R)-3,4,5-triacetyloxyoxolan-2-yl]methyl acetate. InChIKey: IHNHAHWGVLXCCI-LPWJVIDDSA-N.
| Molecular formula | C13H18O9 |
|---|---|
| Molecular weight | 318.28 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-3,4,5-triacetyloxyoxolan-2-yl]methyl acetate |
| InChIKey | IHNHAHWGVLXCCI-LPWJVIDDSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@H]([C@H](O1)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)