Products 61849-90-9
CAS 61849-90-9 is the registry number for Ribavirin Impurity 12. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3S,4S,5R)-3,4,5-triacetyloxyoxolan-2-yl]methyl acetate (CAS 61849-90-9) is a chemical compound with the molecular formula C13H18O9 and a molecular weight of 318.28 g/mol. IUPAC name: [(2R,3S,4S,5R)-3,4,5-triacetyloxyoxolan-2-yl]methyl acetate. InChIKey: IHNHAHWGVLXCCI-VOAKCMCISA-N.
| Molecular formula | C13H18O9 |
|---|---|
| Molecular weight | 318.28 g/mol |
| IUPAC name | [(2R,3S,4S,5R)-3,4,5-triacetyloxyoxolan-2-yl]methyl acetate |
| InChIKey | IHNHAHWGVLXCCI-VOAKCMCISA-N |
| SMILES | CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H](O1)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)