CAS 4049-34-7 appears in our catalog under these names: Beta-d-ribopyranose 1,2,3,4-tetraacetate, 95%, (2S,3R,4R,5R)–Tetrahydro–2H–pyran–2,3,4,5–tetrayl tetraacetate, Tetra-O-acetyl-beta-D-ribopyranose, >98.0%(GC), 1,2,3,4-Tetra-O-acetyl-β-D-ribopyranose, (2S,3R,4R,5R)-Tetrahydro-2H-pyran-2,3,4,5-tetrayl tetraacetate, 98.0%, 98.0%. Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 10g, 25g, 5g, 100g, 50g.
[(3R,4R,5R,6S)-4,5,6-triacetyloxyoxan-3-yl] acetate (CAS 4049-34-7) is a chemical compound with the molecular formula C13H18O9 and a molecular weight of 318.28 g/mol. IUPAC name: [(3R,4R,5R,6S)-4,5,6-triacetyloxyoxan-3-yl] acetate. InChIKey: MJOQJPYNENPSSS-LPWJVIDDSA-N.
| Molecular formula | C13H18O9 |
|---|---|
| Molecular weight | 318.28 g/mol |
| IUPAC name | [(3R,4R,5R,6S)-4,5,6-triacetyloxyoxan-3-yl] acetate |
| InChIKey | MJOQJPYNENPSSS-LPWJVIDDSA-N |
| SMILES | CC(=O)O[C@@H]1CO[C@H]([C@@H]([C@@H]1OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)