CAS 108646-05-5 appears in our catalog under these names: (3S,4R,5R)-Tetrahydro-2h-pyran-2,3,4,5-tetrayl tetraacetate, 95%, (3S,4R,5R)–Tetrahydro–2H–pyran–2,3,4,5–tetrayl tetraacetate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 10g.
[(3R,4R,5S)-4,5,6-triacetyloxyoxan-3-yl] acetate (CAS 108646-05-5) is a chemical compound with the molecular formula C13H18O9 and a molecular weight of 318.28 g/mol. IUPAC name: [(3R,4R,5S)-4,5,6-triacetyloxyoxan-3-yl] acetate. InChIKey: MJOQJPYNENPSSS-FKJOKYEKSA-N.
| Molecular formula | C13H18O9 |
|---|---|
| Molecular weight | 318.28 g/mol |
| IUPAC name | [(3R,4R,5S)-4,5,6-triacetyloxyoxan-3-yl] acetate |
| InChIKey | MJOQJPYNENPSSS-FKJOKYEKSA-N |
| SMILES | CC(=O)O[C@@H]1COC([C@H]([C@@H]1OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)