Products 3891-58-5

CAS 3891-58-5 is the registry number for D-Arabinose tetraacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.

Structural formula: {0} (CAS {1})

(2,3,4-triacetyloxy-5-oxopentyl) acetate (CAS 3891-58-5) is a chemical compound with the molecular formula C13H18O9 and a molecular weight of 318.28 g/mol. IUPAC name: (2,3,4-triacetyloxy-5-oxopentyl) acetate. InChIKey: ZYPMNZKYVVSXOJ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18O9
Molecular weight318.28 g/mol
IUPAC name(2,3,4-triacetyloxy-5-oxopentyl) acetate
InChIKeyZYPMNZKYVVSXOJ-UHFFFAOYSA-N
SMILESCC(=O)OCC(C(C(C=O)OC(=O)C)OC(=O)C)OC(=O)C

Computed by PubChem (NCBI)