Products 2322358-20-1
CAS 2322358-20-1 appears in our catalog under these names: 6–Benzylaminopurine–d5, 6-Benzylaminopurine-d5, 98%, 98%, 6-Benzylaminopurine-d5, 98.0%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 1 mg, 5 mg, 10 mg.
N-[(2,3,4,5,6-pentadeuteriophenyl)methyl]-7H-purin-6-amine (CAS 2322358-20-1) is a chemical compound with the molecular formula C12H11N5 and a molecular weight of 230.28 g/mol. IUPAC name: N-[(2,3,4,5,6-pentadeuteriophenyl)methyl]-7H-purin-6-amine. InChIKey: NWBJYWHLCVSVIJ-RALIUCGRSA-N.
| Molecular formula | C12H11N5 |
|---|---|
| Molecular weight | 230.28 g/mol |
| IUPAC name | N-[(2,3,4,5,6-pentadeuteriophenyl)methyl]-7H-purin-6-amine |
| InChIKey | NWBJYWHLCVSVIJ-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])CNC2=NC=NC3=C2NC=N3)[2H])[2H] |
Computed by PubChem (NCBI)