Products 2323061-55-6
CAS 2323061-55-6 is the registry number for (R)-2-Amino-2-(2,6-difluorophenyl)ethan-1-ol hydrochloride, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-amino-2-(2,6-difluorophenyl)ethanol;hydrochloride (CAS 2323061-55-6) is a chemical compound with the molecular formula C8H10ClF2NO and a molecular weight of 209.62 g/mol. IUPAC name: (2R)-2-amino-2-(2,6-difluorophenyl)ethanol;hydrochloride. InChIKey: MFSSAKCSXPXIQU-FJXQXJEOSA-N.
| Molecular formula | C8H10ClF2NO |
|---|---|
| Molecular weight | 209.62 g/mol |
| IUPAC name | (2R)-2-amino-2-(2,6-difluorophenyl)ethanol;hydrochloride |
| InChIKey | MFSSAKCSXPXIQU-FJXQXJEOSA-N |
| SMILES | C1=CC(=C(C(=C1)F)[C@H](CO)N)F.Cl |
Computed by PubChem (NCBI)