Products 2324177-95-7
CAS 2324177-95-7 is the registry number for methyl 2,3-dibromo-5-fluoro-4-methyl-benzoate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl 2,3-dibromo-5-fluoro-4-methylbenzoate (CAS 2324177-95-7) is a chemical compound with the molecular formula C9H7Br2FO2 and a molecular weight of 325.96 g/mol. IUPAC name: methyl 2,3-dibromo-5-fluoro-4-methylbenzoate. InChIKey: VONMYVUXQPKGOT-UHFFFAOYSA-N.
| Molecular formula | C9H7Br2FO2 |
|---|---|
| Molecular weight | 325.96 g/mol |
| IUPAC name | methyl 2,3-dibromo-5-fluoro-4-methylbenzoate |
| InChIKey | VONMYVUXQPKGOT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1Br)Br)C(=O)OC)F |
Computed by PubChem (NCBI)